C20H34N4O3S — CID 55656712
N-[4-(4-methylpiperazin-1-yl)butyl]-4-[methyl(propan-2-yl)sulfamoyl]benzamide (PubChem CID 55656712) has the molecular formula C20H34N4O3S and a molecular weight of 410.58 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)butyl]-4-[methyl(propan-2-yl)sulfamoyl]benzamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)butyl]-4-[methyl(propan-2-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55656712 |
| Molecular Formula | C20H34N4O3S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)butyl]-4-[methyl(propan-2-yl)sulfamoyl]benzamide |
| SMILES | CC(C)N(C)S(=O)(=O)c1ccc(C(=O)NCCCCN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C20H34N4O3S/c1-17(2)23(4)28(26,27)19-9-7-18(8-10-19)20(25)21-11-5-6-12-24-15-13-22(3)14-16-24/h7-10,17H,5-6,11-16H2,1-4H3,(H,21,25) |
| InChIKey | OGRCLAIPHIKFCL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|