C20H33N3O3S — CID 35415769
N-[3-(4-methylpiperidin-1-yl)propyl]-3-[methyl(propan-2-yl)sulfamoyl]benzamide (PubChem CID 35415769) has the molecular formula C20H33N3O3S and a molecular weight of 395.57 g/mol. Its IUPAC name is N-[3-(4-methylpiperidin-1-yl)propyl]-3-[methyl(propan-2-yl)sulfamoyl]benzamide.
| Compound Name | N-[3-(4-methylpiperidin-1-yl)propyl]-3-[methyl(propan-2-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 35415769 |
| Molecular Formula | C20H33N3O3S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[3-(4-methylpiperidin-1-yl)propyl]-3-[methyl(propan-2-yl)sulfamoyl]benzamide |
| SMILES | CC1CCN(CCCNC(=O)c2cccc(S(=O)(=O)N(C)C(C)C)c2)CC1 |
| InChI | InChI=1S/C20H33N3O3S/c1-16(2)22(4)27(25,26)19-8-5-7-18(15-19)20(24)21-11-6-12-23-13-9-17(3)10-14-23/h5,7-8,15-17H,6,9-14H2,1-4H3,(H,21,24) |
| InChIKey | RIXDQDPXMJFWJC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|