C24H34N4O4S — CID 55634096
N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 55634096) has the molecular formula C24H34N4O4S and a molecular weight of 474.63 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55634096 |
| Molecular Formula | C24H34N4O4S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)NCCCN2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H34N4O4S/c1-32-19-13-26-33(30,31)23-10-8-22(9-11-23)24(29)25-12-5-14-27-15-17-28(18-16-27)20-21-6-3-2-4-7-21/h2-4,6-11,26H,5,12-20H2,1H3,(H,25,29) |
| InChIKey | PSXXMMFALXBIDJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|