C16H25N3O5S — CID 109059683
N-(2-methoxyethyl)-4-(2-morpholin-4-ylethylsulfamoyl)benzamide (PubChem CID 109059683) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-(2-morpholin-4-ylethylsulfamoyl)benzamide.
| Compound Name | N-(2-methoxyethyl)-4-(2-morpholin-4-ylethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 109059683 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-(2-methoxyethyl)-4-(2-morpholin-4-ylethylsulfamoyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(S(=O)(=O)NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C16H25N3O5S/c1-23-11-7-17-16(20)14-2-4-15(5-3-14)25(21,22)18-6-8-19-9-12-24-13-10-19/h2-5,18H,6-13H2,1H3,(H,17,20) |
| InChIKey | MPEZNPPIKSZYOI-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|