C18H28N2O7S — CID 56603480
4-tert-butyl-N-(2-morpholin-4-ylethyl)benzenesulfonamide;oxalic acid (PubChem CID 56603480) has the molecular formula C18H28N2O7S and a molecular weight of 416.50 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-morpholin-4-ylethyl)benzenesulfonamide;oxalic acid.
| Compound Name | 4-tert-butyl-N-(2-morpholin-4-ylethyl)benzenesulfonamide;oxalic acid |
|---|---|
| PubChem CID | 56603480 |
| Molecular Formula | C18H28N2O7S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-tert-butyl-N-(2-morpholin-4-ylethyl)benzenesulfonamide;oxalic acid |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCCN2CCOCC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H26N2O3S.C2H2O4/c1-16(2,3)14-4-6-15(7-5-14)22(19,20)17-8-9-18-10-12-21-13-11-18;3-1(4)2(5)6/h4-7,17H,8-13H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | XKPQPPNUULESEA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|