C16H27ClN4O4S — CID 119446751
4-(2-methoxyethylsulfamoyl)-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride (PubChem CID 119446751) has the molecular formula C16H27ClN4O4S and a molecular weight of 406.94 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfamoyl)-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride.
| Compound Name | 4-(2-methoxyethylsulfamoyl)-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119446751 |
| Molecular Formula | C16H27ClN4O4S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-(2-methoxyethylsulfamoyl)-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)NCCN2CCNCC2)cc1.Cl |
| InChI | InChI=1S/C16H26N4O4S.ClH/c1-24-13-9-19-25(22,23)15-4-2-14(3-5-15)16(21)18-8-12-20-10-6-17-7-11-20;/h2-5,17,19H,6-13H2,1H3,(H,18,21);1H |
| InChIKey | TZKMZYQNKWGPLD-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|