C16H28Cl2N4O3S — CID 119994662
N,N-dimethyl-3-(3-piperazin-1-ylpropylsulfamoyl)benzamide;dihydrochloride (PubChem CID 119994662) has the molecular formula C16H28Cl2N4O3S and a molecular weight of 427.40 g/mol. Its IUPAC name is N,N-dimethyl-3-(3-piperazin-1-ylpropylsulfamoyl)benzamide;dihydrochloride.
| Compound Name | N,N-dimethyl-3-(3-piperazin-1-ylpropylsulfamoyl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119994662 |
| Molecular Formula | C16H28Cl2N4O3S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N,N-dimethyl-3-(3-piperazin-1-ylpropylsulfamoyl)benzamide;dihydrochloride |
| SMILES | CN(C)C(=O)c1cccc(S(=O)(=O)NCCCN2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C16H26N4O3S.2ClH/c1-19(2)16(21)14-5-3-6-15(13-14)24(22,23)18-7-4-10-20-11-8-17-9-12-20;;/h3,5-6,13,17-18H,4,7-12H2,1-2H3;2*1H |
| InChIKey | SEKVAQIOULVLOG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|