C12H22Cl2N4O2S — CID 119994569
N-(3-piperazin-1-ylpropyl)pyridine-3-sulfonamide;dihydrochloride (PubChem CID 119994569) has the molecular formula C12H22Cl2N4O2S and a molecular weight of 357.31 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)pyridine-3-sulfonamide;dihydrochloride.
| Compound Name | N-(3-piperazin-1-ylpropyl)pyridine-3-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 119994569 |
| Molecular Formula | C12H22Cl2N4O2S |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)pyridine-3-sulfonamide;dihydrochloride |
| SMILES | Cl.Cl.O=S(=O)(NCCCN1CCNCC1)c1cccnc1 |
| InChI | InChI=1S/C12H20N4O2S.2ClH/c17-19(18,12-3-1-4-14-11-12)15-5-2-8-16-9-6-13-7-10-16;;/h1,3-4,11,13,15H,2,5-10H2;2*1H |
| InChIKey | WUUWNXCJJYVMHY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|