C12H22Cl3N3 — CID 86694323
1-(3-pyridin-3-ylpropyl)piperazine;trihydrochloride (PubChem CID 86694323) has the molecular formula C12H22Cl3N3 and a molecular weight of 314.69 g/mol. Its IUPAC name is 1-(3-pyridin-3-ylpropyl)piperazine;trihydrochloride.
| Compound Name | 1-(3-pyridin-3-ylpropyl)piperazine;trihydrochloride |
|---|---|
| PubChem CID | 86694323 |
| Molecular Formula | C12H22Cl3N3 |
| Molecular Weight | 314.69 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 1-(3-pyridin-3-ylpropyl)piperazine;trihydrochloride |
| SMILES | Cl.Cl.Cl.c1cncc(CCCN2CCNCC2)c1 |
| InChI | InChI=1S/C12H19N3.3ClH/c1-3-12(11-14-5-1)4-2-8-15-9-6-13-7-10-15;;;/h1,3,5,11,13H,2,4,6-10H2;3*1H |
| InChIKey | YKMGMBFUBDFJMC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.69 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |