C19H24FN3 — CID 171906407
1-(4-fluorophenyl)-4-(3-pyridin-3-ylpropyl)-1,4-diazepane (PubChem CID 171906407) has the molecular formula C19H24FN3 and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(3-pyridin-3-ylpropyl)-1,4-diazepane.
| Compound Name | 1-(4-fluorophenyl)-4-(3-pyridin-3-ylpropyl)-1,4-diazepane |
|---|---|
| PubChem CID | 171906407 |
| Molecular Formula | C19H24FN3 |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(3-pyridin-3-ylpropyl)-1,4-diazepane |
| SMILES | Fc1ccc(N2CCCN(CCCc3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C19H24FN3/c20-18-6-8-19(9-7-18)23-13-3-12-22(14-15-23)11-2-5-17-4-1-10-21-16-17/h1,4,6-10,16H,2-3,5,11-15H2 |
| InChIKey | XAPCYBZNTKCSKM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |