C22H28FN3O — CID 110608671
1-[4-[3-(3-fluorophenyl)propyl]piperazin-1-yl]-4-pyridin-3-ylbutan-1-one (PubChem CID 110608671) has the molecular formula C22H28FN3O and a molecular weight of 369.48 g/mol. Its IUPAC name is 1-[4-[3-(3-fluorophenyl)propyl]piperazin-1-yl]-4-pyridin-3-ylbutan-1-one.
| Compound Name | 1-[4-[3-(3-fluorophenyl)propyl]piperazin-1-yl]-4-pyridin-3-ylbutan-1-one |
|---|---|
| PubChem CID | 110608671 |
| Molecular Formula | C22H28FN3O |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 1-[4-[3-(3-fluorophenyl)propyl]piperazin-1-yl]-4-pyridin-3-ylbutan-1-one |
| SMILES | O=C(CCCc1cccnc1)N1CCN(CCCc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C22H28FN3O/c23-21-9-1-5-19(17-21)8-4-12-25-13-15-26(16-14-25)22(27)10-2-6-20-7-3-11-24-18-20/h1,3,5,7,9,11,17-18H,2,4,6,8,10,12-16H2 |
| InChIKey | ZCUOMFJUZHQGDA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |