C19H27FN2O — CID 110608661
2-cyclopropyl-1-[4-[3-(3-fluorophenyl)propyl]piperazin-1-yl]propan-1-one (PubChem CID 110608661) has the molecular formula C19H27FN2O and a molecular weight of 318.44 g/mol. Its IUPAC name is 2-cyclopropyl-1-[4-[3-(3-fluorophenyl)propyl]piperazin-1-yl]propan-1-one.
| Compound Name | 2-cyclopropyl-1-[4-[3-(3-fluorophenyl)propyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 110608661 |
| Molecular Formula | C19H27FN2O |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 2-cyclopropyl-1-[4-[3-(3-fluorophenyl)propyl]piperazin-1-yl]propan-1-one |
| SMILES | CC(C(=O)N1CCN(CCCc2cccc(F)c2)CC1)C1CC1 |
| InChI | InChI=1S/C19H27FN2O/c1-15(17-7-8-17)19(23)22-12-10-21(11-13-22)9-3-5-16-4-2-6-18(20)14-16/h2,4,6,14-15,17H,3,5,7-13H2,1H3 |
| InChIKey | KLABKNHFONAYRE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |