C22H27FN2O4 — CID 90483959
1-[(3-fluorophenyl)methyl]-4-(3-phenylpropyl)piperazine;oxalic acid (PubChem CID 90483959) has the molecular formula C22H27FN2O4 and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-4-(3-phenylpropyl)piperazine;oxalic acid.
| Compound Name | 1-[(3-fluorophenyl)methyl]-4-(3-phenylpropyl)piperazine;oxalic acid |
|---|---|
| PubChem CID | 90483959 |
| Molecular Formula | C22H27FN2O4 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-4-(3-phenylpropyl)piperazine;oxalic acid |
| SMILES | Fc1cccc(CN2CCN(CCCc3ccccc3)CC2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H25FN2.C2H2O4/c21-20-10-4-8-19(16-20)17-23-14-12-22(13-15-23)11-5-9-18-6-2-1-3-7-18;3-1(4)2(5)6/h1-4,6-8,10,16H,5,9,11-15,17H2;(H,3,4)(H,5,6) |
| InChIKey | GSYROIVPRYJEHX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|