C19H23FN2O2S — CID 55439469
1-(3-fluorophenyl)sulfonyl-4-(3-phenylpropyl)piperazine (PubChem CID 55439469) has the molecular formula C19H23FN2O2S and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfonyl-4-(3-phenylpropyl)piperazine.
| Compound Name | 1-(3-fluorophenyl)sulfonyl-4-(3-phenylpropyl)piperazine |
|---|---|
| PubChem CID | 55439469 |
| Molecular Formula | C19H23FN2O2S |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-(3-fluorophenyl)sulfonyl-4-(3-phenylpropyl)piperazine |
| SMILES | O=S(=O)(c1cccc(F)c1)N1CCN(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H23FN2O2S/c20-18-9-4-10-19(16-18)25(23,24)22-14-12-21(13-15-22)11-5-8-17-6-2-1-3-7-17/h1-4,6-7,9-10,16H,5,8,11-15H2 |
| InChIKey | HJWILYRMEGUTCJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |