C20H26N2O2S — CID 1072237
1-(4-methylphenyl)sulfonyl-4-(3-phenylpropyl)piperazine (PubChem CID 1072237) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4-(3-phenylpropyl)piperazine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4-(3-phenylpropyl)piperazine |
|---|---|
| PubChem CID | 1072237 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4-(3-phenylpropyl)piperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CCCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H26N2O2S/c1-18-9-11-20(12-10-18)25(23,24)22-16-14-21(15-17-22)13-5-8-19-6-3-2-4-7-19/h2-4,6-7,9-12H,5,8,13-17H2,1H3 |
| InChIKey | ORWAJIREOYESDV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |