C43H50N4O8S4 — CID 124870685
(2S)-2-benzyl-1,4,7,10-tetrakis-(4-methylphenyl)sulfonyl-1,4,7,10-tetrazacyclododecane (PubChem CID 124870685) has the molecular formula C43H50N4O8S4 and a molecular weight of 879.16 g/mol. Its IUPAC name is (2S)-2-benzyl-1,4,7,10-tetrakis-(4-methylphenyl)sulfonyl-1,4,7,10-tetrazacyclododecane.
| Compound Name | (2S)-2-benzyl-1,4,7,10-tetrakis-(4-methylphenyl)sulfonyl-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 124870685 |
| Molecular Formula | C43H50N4O8S4 |
| Molecular Weight | 879.16 g/mol |
| Exact Mass | 878.25 |
| IUPAC Name | (2S)-2-benzyl-1,4,7,10-tetrakis-(4-methylphenyl)sulfonyl-1,4,7,10-tetrazacyclododecane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(C)cc3)CCN(S(=O)(=O)c3ccc(C)cc3)[C@@H](Cc3ccccc3)CN(S(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C43H50N4O8S4/c1-34-10-18-40(19-11-34)56(48,49)44-26-27-45(57(50,51)41-20-12-35(2)13-21-41)30-31-47(59(54,55)43-24-16-37(4)17-25-43)39(32-38-8-6-5-7-9-38)33-46(29-28-44)58(52,53)42-22-14-36(3)15-23-42/h5-25,39H,26-33H2,1-4H3/t39-/m0/s1 |
| InChIKey | STNZNCWQNMGRIM-KDXMTYKHSA-N |
| XLogP | 5.61 |
| TPSA | 149.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.16 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |