C26H29N3O6S2 — CID 146745624
1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane (PubChem CID 146745624) has the molecular formula C26H29N3O6S2 and a molecular weight of 543.67 g/mol. Its IUPAC name is 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane.
| Compound Name | 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 146745624 |
| Molecular Formula | C26H29N3O6S2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(S(=O)(=O)c3ccc(C)cc3)C(Cc3ccc([N+](=O)[O-])cc3)C2)cc1 |
| InChI | InChI=1S/C26H29N3O6S2/c1-20-4-12-25(13-5-20)36(32,33)27-16-3-17-28(37(34,35)26-14-6-21(2)7-15-26)24(19-27)18-22-8-10-23(11-9-22)29(30)31/h4-15,24H,3,16-19H2,1-2H3 |
| InChIKey | RLYHIDBBSRAVPD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|