About 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane
1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane (PubChem CID 146745624) has the molecular formula C26H29N3O6S2
and a molecular weight of 543.67 g/mol. Its IUPAC name is 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane.
Molecular Properties
| Compound Name | 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane |
| PubChem CID | 146745624 |
| Molecular Formula | C26H29N3O6S2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(S(=O)(=O)c3ccc(C)cc3)C(Cc3ccc([N+](=O)[O-])cc3)C2)cc1 |
| InChI | InChI=1S/C26H29N3O6S2/c1-20-4-12-25(13-5-20)36(32,33)27-16-3-17-28(37(34,35)26-14-6-21(2)7-15-26)24(19-27)18-22-8-10-23(11-9-22)29(30)31/h4-15,24H,3,16-19H2,1-2H3 |
| InChIKey | RLYHIDBBSRAVPD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane?
The IUPAC name of 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane (CID 146745624) is 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane.
What is the SMILES notation for 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane?
The canonical SMILES for 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane is Cc1ccc(S(=O)(=O)N2CCCN(S(=O)(=O)c3ccc(C)cc3)C(Cc3ccc([N+](=O)[O-])cc3)C2)cc1.
What is the InChIKey of 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane?
The InChIKey is RLYHIDBBSRAVPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29N3O6S2/c1-20-4-12-25(13-5-20)36(32,33)27-16-3-17-28(37(34,35)26-14-6-21(2)7-15-26)24(19-27)18-22-8-10-23(11-9-22)29(30)31/h4-15,24H,3,16-19H2,1-2H3.
What are the key properties of 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane?
1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane has a molecular weight of 543.67 g/mol, XLogP of 3.91, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis-(4-methylphenyl)sulfonyl-2-[(4-nitrophenyl)methyl]-1,4-diazepane is sourced from PubChem (CID 146745624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).