C25H27N3O7S2 — CID 102293017
N-[[(2S,5S)-5-benzyl-4-(4-nitrophenyl)sulfonylmorpholin-2-yl]methyl]-4-methylbenzenesulfonamide (PubChem CID 102293017) has the molecular formula C25H27N3O7S2 and a molecular weight of 545.64 g/mol. Its IUPAC name is N-[[(2S,5S)-5-benzyl-4-(4-nitrophenyl)sulfonylmorpholin-2-yl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[(2S,5S)-5-benzyl-4-(4-nitrophenyl)sulfonylmorpholin-2-yl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102293017 |
| Molecular Formula | C25H27N3O7S2 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | N-[[(2S,5S)-5-benzyl-4-(4-nitrophenyl)sulfonylmorpholin-2-yl]methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@H]2CN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)[C@@H](Cc3ccccc3)CO2)cc1 |
| InChI | InChI=1S/C25H27N3O7S2/c1-19-7-11-24(12-8-19)36(31,32)26-16-23-17-27(22(18-35-23)15-20-5-3-2-4-6-20)37(33,34)25-13-9-21(10-14-25)28(29)30/h2-14,22-23,26H,15-18H2,1H3/t22-,23-/m0/s1 |
| InChIKey | NDHANSNRZRNLNR-GOTSBHOMSA-N |
| XLogP | 2.88 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|