C27H30N2O4S2 — CID 10929319
(3S,6R)-6-benzyl-1,7-bis-(4-methylphenyl)sulfonyl-1,7-diazaspiro[2.5]octane (PubChem CID 10929319) has the molecular formula C27H30N2O4S2 and a molecular weight of 510.68 g/mol. Its IUPAC name is (3S,6R)-6-benzyl-1,7-bis-(4-methylphenyl)sulfonyl-1,7-diazaspiro[2.5]octane.
| Compound Name | (3S,6R)-6-benzyl-1,7-bis-(4-methylphenyl)sulfonyl-1,7-diazaspiro[2.5]octane |
|---|---|
| PubChem CID | 10929319 |
| Molecular Formula | C27H30N2O4S2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | (3S,6R)-6-benzyl-1,7-bis-(4-methylphenyl)sulfonyl-1,7-diazaspiro[2.5]octane |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@]3(CC[C@@H]2Cc2ccccc2)CN3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H30N2O4S2/c1-21-8-12-25(13-9-21)34(30,31)28-19-27(17-16-24(28)18-23-6-4-3-5-7-23)20-29(27)35(32,33)26-14-10-22(2)11-15-26/h3-15,24H,16-20H2,1-2H3/t24-,27-,29?/m1/s1 |
| InChIKey | SEYQHKYLXMHWRH-MPXLCVCVSA-N |
| XLogP | 4.14 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|