C24H24INO2S — CID 102531052
2-(iodomethyl)-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine (PubChem CID 102531052) has the molecular formula C24H24INO2S and a molecular weight of 517.43 g/mol. Its IUPAC name is 2-(iodomethyl)-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine.
| Compound Name | 2-(iodomethyl)-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine |
|---|---|
| PubChem CID | 102531052 |
| Molecular Formula | C24H24INO2S |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | 2-(iodomethyl)-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(c3ccccc3)(c3ccccc3)CC2CI)cc1 |
| InChI | InChI=1S/C24H24INO2S/c1-19-12-14-23(15-13-19)29(27,28)26-18-24(16-22(26)17-25,20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15,22H,16-18H2,1H3 |
| InChIKey | QOOOTKJZXSWKTL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|