C25H25NO3S — CID 134958502
5-ethyl-1-(4-methylphenyl)sulfonyl-3,3-diphenylpyrrolidin-2-one (PubChem CID 134958502) has the molecular formula C25H25NO3S and a molecular weight of 419.55 g/mol. Its IUPAC name is 5-ethyl-1-(4-methylphenyl)sulfonyl-3,3-diphenylpyrrolidin-2-one.
| Compound Name | 5-ethyl-1-(4-methylphenyl)sulfonyl-3,3-diphenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 134958502 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 5-ethyl-1-(4-methylphenyl)sulfonyl-3,3-diphenylpyrrolidin-2-one |
| SMILES | CCC1CC(c2ccccc2)(c2ccccc2)C(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H25NO3S/c1-3-22-18-25(20-10-6-4-7-11-20,21-12-8-5-9-13-21)24(27)26(22)30(28,29)23-16-14-19(2)15-17-23/h4-17,22H,3,18H2,1-2H3 |
| InChIKey | ARGNOWDUODCBKK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |