C19H22INO2S — CID 10950521
(2R,3S,5S)-5-ethyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine (PubChem CID 10950521) has the molecular formula C19H22INO2S and a molecular weight of 455.36 g/mol. Its IUPAC name is (2R,3S,5S)-5-ethyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine.
| Compound Name | (2R,3S,5S)-5-ethyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine |
|---|---|
| PubChem CID | 10950521 |
| Molecular Formula | C19H22INO2S |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | (2R,3S,5S)-5-ethyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine |
| SMILES | CC[C@H]1C[C@H](I)[C@@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H22INO2S/c1-3-16-13-18(20)19(15-7-5-4-6-8-15)21(16)24(22,23)17-11-9-14(2)10-12-17/h4-12,16,18-19H,3,13H2,1-2H3/t16-,18-,19+/m0/s1 |
| InChIKey | JLBTWBSDNBTSNH-YTQUADARSA-N |
| XLogP | 4.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|