C21H18FNO2S — CID 24764030
(2S,3S)-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-3-phenylaziridine (PubChem CID 24764030) has the molecular formula C21H18FNO2S and a molecular weight of 367.45 g/mol. Its IUPAC name is (2S,3S)-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-3-phenylaziridine.
| Compound Name | (2S,3S)-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-3-phenylaziridine |
|---|---|
| PubChem CID | 24764030 |
| Molecular Formula | C21H18FNO2S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (2S,3S)-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-3-phenylaziridine |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](c3ccccc3)[C@@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H18FNO2S/c1-15-7-13-19(14-8-15)26(24,25)23-20(16-5-3-2-4-6-16)21(23)17-9-11-18(22)12-10-17/h2-14,20-21H,1H3/t20-,21-,23?/m0/s1 |
| InChIKey | KOWBWDOGNJEODK-MMBKUXRPSA-N |
| XLogP | 4.62 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|