C15H14FNO2S — CID 101342795
(2R)-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylaziridine (PubChem CID 101342795) has the molecular formula C15H14FNO2S and a molecular weight of 291.35 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylaziridine.
| Compound Name | (2R)-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylaziridine |
|---|---|
| PubChem CID | 101342795 |
| Molecular Formula | C15H14FNO2S |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (2R)-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylaziridine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C15H14FNO2S/c1-11-2-8-14(9-3-11)20(18,19)17-10-15(17)12-4-6-13(16)7-5-12/h2-9,15H,10H2,1H3/t15-,17?/m0/s1 |
| InChIKey | MVLFQWCYAPNTES-MYJWUSKBSA-N |
| XLogP | 2.88 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|