C16H16FNO2S2 — CID 86224667
3-(4-fluorophenyl)-2-(4-methylphenyl)sulfonyl-1,2-thiazolidine (PubChem CID 86224667) has the molecular formula C16H16FNO2S2 and a molecular weight of 337.44 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-(4-methylphenyl)sulfonyl-1,2-thiazolidine.
| Compound Name | 3-(4-fluorophenyl)-2-(4-methylphenyl)sulfonyl-1,2-thiazolidine |
|---|---|
| PubChem CID | 86224667 |
| Molecular Formula | C16H16FNO2S2 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 3-(4-fluorophenyl)-2-(4-methylphenyl)sulfonyl-1,2-thiazolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2SCCC2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H16FNO2S2/c1-12-2-8-15(9-3-12)22(19,20)18-16(10-11-21-18)13-4-6-14(17)7-5-13/h2-9,16H,10-11H2,1H3 |
| InChIKey | VEYPYNUVQMCASN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|