C21H25ClFNO2S — CID 22250478
2-(4-chlorobutyl)-5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 22250478) has the molecular formula C21H25ClFNO2S and a molecular weight of 409.95 g/mol. Its IUPAC name is 2-(4-chlorobutyl)-5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidine.
| Compound Name | 2-(4-chlorobutyl)-5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 22250478 |
| Molecular Formula | C21H25ClFNO2S |
| Molecular Weight | 409.95 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-(4-chlorobutyl)-5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2C(CCCCCl)CCC2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H25ClFNO2S/c1-16-5-12-20(13-6-16)27(25,26)24-19(4-2-3-15-22)11-14-21(24)17-7-9-18(23)10-8-17/h5-10,12-13,19,21H,2-4,11,14-15H2,1H3 |
| InChIKey | SHZSFXPMWPHZEC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.95 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|