C16H13Cl2F2NO2S — CID 127037449
(2R)-1-(3,5-dichloro-4-fluorophenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine (PubChem CID 127037449) has the molecular formula C16H13Cl2F2NO2S and a molecular weight of 392.25 g/mol. Its IUPAC name is (2R)-1-(3,5-dichloro-4-fluorophenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine.
| Compound Name | (2R)-1-(3,5-dichloro-4-fluorophenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 127037449 |
| Molecular Formula | C16H13Cl2F2NO2S |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | (2R)-1-(3,5-dichloro-4-fluorophenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine |
| SMILES | O=S(=O)(c1cc(Cl)c(F)c(Cl)c1)N1CCC[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13Cl2F2NO2S/c17-13-8-12(9-14(18)16(13)20)24(22,23)21-7-1-2-15(21)10-3-5-11(19)6-4-10/h3-6,8-9,15H,1-2,7H2/t15-/m1/s1 |
| InChIKey | PHGQTOSVXWSIQY-OAHLLOKOSA-N |
| XLogP | 4.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|