C18H20FNO2S — CID 162407869
(2S,5S)-2-(4-fluorophenyl)-5-methyl-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 162407869) has the molecular formula C18H20FNO2S and a molecular weight of 333.43 g/mol. Its IUPAC name is (2S,5S)-2-(4-fluorophenyl)-5-methyl-1-(4-methylphenyl)sulfonylpyrrolidine.
| Compound Name | (2S,5S)-2-(4-fluorophenyl)-5-methyl-1-(4-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 162407869 |
| Molecular Formula | C18H20FNO2S |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (2S,5S)-2-(4-fluorophenyl)-5-methyl-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](C)CC[C@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H20FNO2S/c1-13-3-10-17(11-4-13)23(21,22)20-14(2)5-12-18(20)15-6-8-16(19)9-7-15/h3-4,6-11,14,18H,5,12H2,1-2H3/t14-,18-/m0/s1 |
| InChIKey | JXFZDHBATZYBLW-KSSFIOAISA-N |
| XLogP | 4.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |