C17H19NO2S — CID 59100228
(2R,5R)-1-(benzenesulfonyl)-2-methyl-5-phenylpyrrolidine (PubChem CID 59100228) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is (2R,5R)-1-(benzenesulfonyl)-2-methyl-5-phenylpyrrolidine.
| Compound Name | (2R,5R)-1-(benzenesulfonyl)-2-methyl-5-phenylpyrrolidine |
|---|---|
| PubChem CID | 59100228 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (2R,5R)-1-(benzenesulfonyl)-2-methyl-5-phenylpyrrolidine |
| SMILES | C[C@@H]1CC[C@H](c2ccccc2)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2S/c1-14-12-13-17(15-8-4-2-5-9-15)18(14)21(19,20)16-10-6-3-7-11-16/h2-11,14,17H,12-13H2,1H3/t14-,17-/m1/s1 |
| InChIKey | HUBMJCGJINYQJQ-RHSMWYFYSA-N |
| XLogP | 3.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |