C21H25NO4S — CID 174960067
1-(benzenesulfonyl)-3-tert-butyl-5-phenylpyrrolidine-2-carboxylic acid (PubChem CID 174960067) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-tert-butyl-5-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-(benzenesulfonyl)-3-tert-butyl-5-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 174960067 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 1-(benzenesulfonyl)-3-tert-butyl-5-phenylpyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)C1CC(c2ccccc2)N(S(=O)(=O)c2ccccc2)C1C(=O)O |
| InChI | InChI=1S/C21H25NO4S/c1-21(2,3)17-14-18(15-10-6-4-7-11-15)22(19(17)20(23)24)27(25,26)16-12-8-5-9-13-16/h4-13,17-19H,14H2,1-3H3,(H,23,24) |
| InChIKey | VXUZEEIZUVVSKT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |