C20H23NO4S — CID 134845785
1-[(2R,3R)-1-(benzenesulfonyl)-3-(4-methoxyphenyl)aziridin-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 134845785) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 1-[(2R,3R)-1-(benzenesulfonyl)-3-(4-methoxyphenyl)aziridin-2-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(2R,3R)-1-(benzenesulfonyl)-3-(4-methoxyphenyl)aziridin-2-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 134845785 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-[(2R,3R)-1-(benzenesulfonyl)-3-(4-methoxyphenyl)aziridin-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | COc1ccc([C@@H]2[C@H](C(=O)C(C)(C)C)N2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-20(2,3)19(22)18-17(14-10-12-15(25-4)13-11-14)21(18)26(23,24)16-8-6-5-7-9-16/h5-13,17-18H,1-4H3/t17-,18-,21?/m1/s1 |
| InChIKey | YAPSZKUIPKRBHR-FYQIFJIOSA-N |
| XLogP | 3.42 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|