C21H25NO3S — CID 15206931
2,2-dimethyl-1-[(2R,3S)-3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]propan-1-one (PubChem CID 15206931) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is 2,2-dimethyl-1-[(2R,3S)-3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[(2R,3S)-3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 15206931 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2,2-dimethyl-1-[(2R,3S)-3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]propan-1-one |
| SMILES | Cc1ccc([C@H]2[C@H](C(=O)C(C)(C)C)N2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H25NO3S/c1-14-6-10-16(11-7-14)18-19(20(23)21(3,4)5)22(18)26(24,25)17-12-8-15(2)9-13-17/h6-13,18-19H,1-5H3/t18-,19+,22?/m0/s1 |
| InChIKey | KWYXQHAUBJOQFR-ZKTCVHQMSA-N |
| XLogP | 4.03 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|