C27H27NO4S — CID 177447242
ethyl (E)-2-[(2S,3R)-3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-3-phenylprop-2-enoate (PubChem CID 177447242) has the molecular formula C27H27NO4S and a molecular weight of 461.58 g/mol. Its IUPAC name is ethyl (E)-2-[(2S,3R)-3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-3-phenylprop-2-enoate.
| Compound Name | ethyl (E)-2-[(2S,3R)-3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 177447242 |
| Molecular Formula | C27H27NO4S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | ethyl (E)-2-[(2S,3R)-3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1ccccc1)[C@H]1[C@@H](c2ccc(C)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H27NO4S/c1-4-32-27(29)24(18-21-8-6-5-7-9-21)26-25(22-14-10-19(2)11-15-22)28(26)33(30,31)23-16-12-20(3)13-17-23/h5-18,25-26H,4H2,1-3H3/b24-18+/t25-,26+,28?/m1/s1 |
| InChIKey | WGSXZKSCMLMDAW-PUTHAORVSA-N |
| XLogP | 5.06 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|