C25H28N2O8S — CID 102207925
dimethyl 2-[1-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)aziridin-2-yl]pentylidene]propanedioate (PubChem CID 102207925) has the molecular formula C25H28N2O8S and a molecular weight of 516.57 g/mol. Its IUPAC name is dimethyl 2-[1-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)aziridin-2-yl]pentylidene]propanedioate.
| Compound Name | dimethyl 2-[1-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)aziridin-2-yl]pentylidene]propanedioate |
|---|---|
| PubChem CID | 102207925 |
| Molecular Formula | C25H28N2O8S |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | dimethyl 2-[1-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)aziridin-2-yl]pentylidene]propanedioate |
| SMILES | CCCCC(=C(C(=O)OC)C(=O)OC)[C@@H]1[C@H](c2ccc([N+](=O)[O-])cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H28N2O8S/c1-5-6-7-20(21(24(28)34-3)25(29)35-4)23-22(17-10-12-18(13-11-17)27(30)31)26(23)36(32,33)19-14-8-16(2)9-15-19/h8-15,22-23H,5-7H2,1-4H3/t22-,23+,26?/m0/s1 |
| InChIKey | IJMDNJUENUWPFB-MXKXXCEUSA-N |
| XLogP | 3.85 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|