C17H16N2O6S — CID 11888372
methyl (2R,3R)-1-(4-methylphenyl)sulfonyl-3-(3-nitrophenyl)aziridine-2-carboxylate (PubChem CID 11888372) has the molecular formula C17H16N2O6S and a molecular weight of 376.39 g/mol. Its IUPAC name is methyl (2R,3R)-1-(4-methylphenyl)sulfonyl-3-(3-nitrophenyl)aziridine-2-carboxylate.
| Compound Name | methyl (2R,3R)-1-(4-methylphenyl)sulfonyl-3-(3-nitrophenyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 11888372 |
| Molecular Formula | C17H16N2O6S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | methyl (2R,3R)-1-(4-methylphenyl)sulfonyl-3-(3-nitrophenyl)aziridine-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](c2cccc([N+](=O)[O-])c2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H16N2O6S/c1-11-6-8-14(9-7-11)26(23,24)18-15(16(18)17(20)25-2)12-4-3-5-13(10-12)19(21)22/h3-10,15-16H,1-2H3/t15-,16-,18?/m1/s1 |
| InChIKey | RBAQUACJVUBCJJ-JNIOUFIGSA-N |
| XLogP | 2.19 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|