C17H17N2O6S- — CID 163167177
methyl (2R,3S)-3-[3-[hydroxy(oxido)amino]phenyl]-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate (PubChem CID 163167177) has the molecular formula C17H17N2O6S- and a molecular weight of 377.40 g/mol. Its IUPAC name is methyl (2R,3S)-3-[3-[hydroxy(oxido)amino]phenyl]-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate.
| Compound Name | methyl (2R,3S)-3-[3-[hydroxy(oxido)amino]phenyl]-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 163167177 |
| Molecular Formula | C17H17N2O6S- |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | methyl (2R,3S)-3-[3-[hydroxy(oxido)amino]phenyl]-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2cccc(N([O-])O)c2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H17N2O6S/c1-11-6-8-14(9-7-11)26(23,24)18-15(16(18)17(20)25-2)12-4-3-5-13(10-12)19(21)22/h3-10,15-16,21H,1-2H3/q-1/t15-,16+,18?/m0/s1 |
| InChIKey | BJURSYNCHFHFQB-SWQDIRLTSA-N |
| XLogP | 1.98 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|