C19H22N2O3S — CID 102330824
(2S,3S)-N,N-dimethyl-3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide (PubChem CID 102330824) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is (2S,3S)-N,N-dimethyl-3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide.
| Compound Name | (2S,3S)-N,N-dimethyl-3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide |
|---|---|
| PubChem CID | 102330824 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (2S,3S)-N,N-dimethyl-3-(4-methylphenyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide |
| SMILES | Cc1ccc([C@H]2[C@@H](C(=O)N(C)C)N2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H22N2O3S/c1-13-5-9-15(10-6-13)17-18(19(22)20(3)4)21(17)25(23,24)16-11-7-14(2)8-12-16/h5-12,17-18H,1-4H3/t17-,18-,21?/m0/s1 |
| InChIKey | FESNERGKFWEYPZ-GAOSQQNJSA-N |
| XLogP | 2.51 |
| TPSA | 57.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|