C18H23NO2SSi — CID 15500792
trimethyl-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]silane (PubChem CID 15500792) has the molecular formula C18H23NO2SSi and a molecular weight of 345.54 g/mol. Its IUPAC name is trimethyl-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]silane.
| Compound Name | trimethyl-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]silane |
|---|---|
| PubChem CID | 15500792 |
| Molecular Formula | C18H23NO2SSi |
| Molecular Weight | 345.54 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | trimethyl-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]silane |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H]([Si](C)(C)C)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C18H23NO2SSi/c1-14-10-12-16(13-11-14)22(20,21)19-17(18(19)23(2,3)4)15-8-6-5-7-9-15/h5-13,17-18H,1-4H3/t17-,18+,19?/m0/s1 |
| InChIKey | CCBNOJNYYOWFJL-PAMZHZACSA-N |
| XLogP | 3.99 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|