C23H21NO2S — CID 15252099
(2S,3S)-1-(4-methylphenyl)sulfonyl-2-phenyl-3-[(E)-2-phenylethenyl]aziridine (PubChem CID 15252099) has the molecular formula C23H21NO2S and a molecular weight of 375.49 g/mol. Its IUPAC name is (2S,3S)-1-(4-methylphenyl)sulfonyl-2-phenyl-3-[(E)-2-phenylethenyl]aziridine.
| Compound Name | (2S,3S)-1-(4-methylphenyl)sulfonyl-2-phenyl-3-[(E)-2-phenylethenyl]aziridine |
|---|---|
| PubChem CID | 15252099 |
| Molecular Formula | C23H21NO2S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (2S,3S)-1-(4-methylphenyl)sulfonyl-2-phenyl-3-[(E)-2-phenylethenyl]aziridine |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](/C=C/c3ccccc3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO2S/c1-18-12-15-21(16-13-18)27(25,26)24-22(17-14-19-8-4-2-5-9-19)23(24)20-10-6-3-7-11-20/h2-17,22-23H,1H3/b17-14+/t22-,23-,24?/m0/s1 |
| InChIKey | LBIMNDMOPAUJFA-LGFYVQNKSA-N |
| XLogP | 4.82 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|