C20H21NO2S — CID 134926258
(2R,5R)-2-methyl-1-(4-methylphenyl)sulfonyl-5-[(E)-2-phenylethenyl]-2,5-dihydropyrrole (PubChem CID 134926258) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is (2R,5R)-2-methyl-1-(4-methylphenyl)sulfonyl-5-[(E)-2-phenylethenyl]-2,5-dihydropyrrole.
| Compound Name | (2R,5R)-2-methyl-1-(4-methylphenyl)sulfonyl-5-[(E)-2-phenylethenyl]-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 134926258 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (2R,5R)-2-methyl-1-(4-methylphenyl)sulfonyl-5-[(E)-2-phenylethenyl]-2,5-dihydropyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](C)C=C[C@H]2/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21NO2S/c1-16-8-14-20(15-9-16)24(22,23)21-17(2)10-12-19(21)13-11-18-6-4-3-5-7-18/h3-15,17,19H,1-2H3/b13-11+/t17-,19+/m1/s1 |
| InChIKey | ICCHLHVWRJAPGP-RIBQSRIRSA-N |
| XLogP | 4.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|