C19H21NO3S — CID 162411653
4-(4-methylphenyl)sulfonyl-3-[(E)-2-phenylethenyl]morpholine (PubChem CID 162411653) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-3-[(E)-2-phenylethenyl]morpholine.
| Compound Name | 4-(4-methylphenyl)sulfonyl-3-[(E)-2-phenylethenyl]morpholine |
|---|---|
| PubChem CID | 162411653 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-3-[(E)-2-phenylethenyl]morpholine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H21NO3S/c1-16-7-11-19(12-8-16)24(21,22)20-13-14-23-15-18(20)10-9-17-5-3-2-4-6-17/h2-12,18H,13-15H2,1H3/b10-9+ |
| InChIKey | QSTIGNYIGZSLDN-MDZDMXLPSA-N |
| XLogP | 3.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |