C26H33NO2S — CID 165177345
9-(4-methylphenyl)sulfonyl-8-[(E)-2-phenylethenyl]-9-azaspiro[5.6]dodecane (PubChem CID 165177345) has the molecular formula C26H33NO2S and a molecular weight of 423.62 g/mol. Its IUPAC name is 9-(4-methylphenyl)sulfonyl-8-[(E)-2-phenylethenyl]-9-azaspiro[5.6]dodecane.
| Compound Name | 9-(4-methylphenyl)sulfonyl-8-[(E)-2-phenylethenyl]-9-azaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 165177345 |
| Molecular Formula | C26H33NO2S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 9-(4-methylphenyl)sulfonyl-8-[(E)-2-phenylethenyl]-9-azaspiro[5.6]dodecane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC3(CCCCC3)CC2/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C26H33NO2S/c1-22-11-15-25(16-12-22)30(28,29)27-20-8-19-26(17-6-3-7-18-26)21-24(27)14-13-23-9-4-2-5-10-23/h2,4-5,9-16,24H,3,6-8,17-21H2,1H3/b14-13+ |
| InChIKey | MCVSLATUOPOOFJ-BUHFOSPRSA-N |
| XLogP | 6.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |