C20H22ClNO2S — CID 51033124
(3R,5R)-3-chloro-1-(4-methylphenyl)sulfonyl-5-[(E)-2-phenylethenyl]piperidine (PubChem CID 51033124) has the molecular formula C20H22ClNO2S and a molecular weight of 375.92 g/mol. Its IUPAC name is (3R,5R)-3-chloro-1-(4-methylphenyl)sulfonyl-5-[(E)-2-phenylethenyl]piperidine.
| Compound Name | (3R,5R)-3-chloro-1-(4-methylphenyl)sulfonyl-5-[(E)-2-phenylethenyl]piperidine |
|---|---|
| PubChem CID | 51033124 |
| Molecular Formula | C20H22ClNO2S |
| Molecular Weight | 375.92 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (3R,5R)-3-chloro-1-(4-methylphenyl)sulfonyl-5-[(E)-2-phenylethenyl]piperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](Cl)C[C@H](/C=C/c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H22ClNO2S/c1-16-7-11-20(12-8-16)25(23,24)22-14-18(13-19(21)15-22)10-9-17-5-3-2-4-6-17/h2-12,18-19H,13-15H2,1H3/b10-9+/t18-,19+/m0/s1 |
| InChIKey | KXXKSLVYFPHCAV-NDUHVBCRSA-N |
| XLogP | 4.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.92 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|