C21H23NO3S — CID 166441486
(E,1S)-1-[(3S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]-3-phenylprop-2-en-1-ol (PubChem CID 166441486) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is (E,1S)-1-[(3S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]-3-phenylprop-2-en-1-ol.
| Compound Name | (E,1S)-1-[(3S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]-3-phenylprop-2-en-1-ol |
|---|---|
| PubChem CID | 166441486 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (E,1S)-1-[(3S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]-3-phenylprop-2-en-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=C[C@H]([C@@H](O)/C=C/c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C21H23NO3S/c1-17-9-12-20(13-10-17)26(24,25)22-15-5-8-19(16-22)21(23)14-11-18-6-3-2-4-7-18/h2-14,19,21,23H,15-16H2,1H3/b14-11+/t19-,21-/m0/s1 |
| InChIKey | MCQQXUMQZSESEH-GYUDITIXSA-N |
| XLogP | 3.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|