C19H20FNO3S — CID 166441488
(R)-(4-fluorophenyl)-[(3S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]methanol (PubChem CID 166441488) has the molecular formula C19H20FNO3S and a molecular weight of 361.44 g/mol. Its IUPAC name is (R)-(4-fluorophenyl)-[(3S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]methanol.
| Compound Name | (R)-(4-fluorophenyl)-[(3S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 166441488 |
| Molecular Formula | C19H20FNO3S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (R)-(4-fluorophenyl)-[(3S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=C[C@H]([C@@H](O)c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C19H20FNO3S/c1-14-4-10-18(11-5-14)25(23,24)21-12-2-3-16(13-21)19(22)15-6-8-17(20)9-7-15/h2-11,16,19,22H,12-13H2,1H3/t16-,19-/m0/s1 |
| InChIKey | MOOUWHCSHNWIOG-LPHOPBHVSA-N |
| XLogP | 3.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|