C15H19NO2S — CID 101406646
(3Z,7Z)-1-(4-methylphenyl)sulfonyl-2,5,6,9-tetrahydroazonine (PubChem CID 101406646) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is (3Z,7Z)-1-(4-methylphenyl)sulfonyl-2,5,6,9-tetrahydroazonine.
| Compound Name | (3Z,7Z)-1-(4-methylphenyl)sulfonyl-2,5,6,9-tetrahydroazonine |
|---|---|
| PubChem CID | 101406646 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (3Z,7Z)-1-(4-methylphenyl)sulfonyl-2,5,6,9-tetrahydroazonine |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C=C\CC/C=C\C2)cc1 |
| InChI | InChI=1S/C15H19NO2S/c1-14-8-10-15(11-9-14)19(17,18)16-12-6-4-2-3-5-7-13-16/h4-11H,2-3,12-13H2,1H3/b6-4-,7-5- |
| InChIKey | GYVKZRKMVWAVJO-PEPZGXQESA-N |
| XLogP | 2.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|