C25H26N2O4S2 — CID 132608825
(3Z)-1,6-bis-(4-methylphenyl)sulfonyl-5,7-dihydro-2H-1,6-benzodiazonine (PubChem CID 132608825) has the molecular formula C25H26N2O4S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is (3Z)-1,6-bis-(4-methylphenyl)sulfonyl-5,7-dihydro-2H-1,6-benzodiazonine.
| Compound Name | (3Z)-1,6-bis-(4-methylphenyl)sulfonyl-5,7-dihydro-2H-1,6-benzodiazonine |
|---|---|
| PubChem CID | 132608825 |
| Molecular Formula | C25H26N2O4S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | (3Z)-1,6-bis-(4-methylphenyl)sulfonyl-5,7-dihydro-2H-1,6-benzodiazonine |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C=C\CN(S(=O)(=O)c3ccc(C)cc3)c3ccccc3C2)cc1 |
| InChI | InChI=1S/C25H26N2O4S2/c1-20-9-13-23(14-10-20)32(28,29)26-17-5-6-18-27(25-8-4-3-7-22(25)19-26)33(30,31)24-15-11-21(2)12-16-24/h3-16H,17-19H2,1-2H3/b6-5- |
| InChIKey | MEEPPDRRJFWXOF-WAYWQWQTSA-N |
| XLogP | 4.26 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|