C16H17NO2S2 — CID 102420468
4-(4-methylphenyl)sulfonyl-3,5-dihydro-2H-1,4-benzothiazepine (PubChem CID 102420468) has the molecular formula C16H17NO2S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-3,5-dihydro-2H-1,4-benzothiazepine.
| Compound Name | 4-(4-methylphenyl)sulfonyl-3,5-dihydro-2H-1,4-benzothiazepine |
|---|---|
| PubChem CID | 102420468 |
| Molecular Formula | C16H17NO2S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-3,5-dihydro-2H-1,4-benzothiazepine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCSc3ccccc3C2)cc1 |
| InChI | InChI=1S/C16H17NO2S2/c1-13-6-8-15(9-7-13)21(18,19)17-10-11-20-16-5-3-2-4-14(16)12-17/h2-9H,10-12H2,1H3 |
| InChIKey | INRKBZBJQGSEIZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |