C13H17NO2S2 — CID 139356259
(6Z)-4-(4-methylphenyl)sulfonyl-2,3,5,8-tetrahydro-1,4-thiazocine (PubChem CID 139356259) has the molecular formula C13H17NO2S2 and a molecular weight of 283.42 g/mol. Its IUPAC name is (6Z)-4-(4-methylphenyl)sulfonyl-2,3,5,8-tetrahydro-1,4-thiazocine.
| Compound Name | (6Z)-4-(4-methylphenyl)sulfonyl-2,3,5,8-tetrahydro-1,4-thiazocine |
|---|---|
| PubChem CID | 139356259 |
| Molecular Formula | C13H17NO2S2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | (6Z)-4-(4-methylphenyl)sulfonyl-2,3,5,8-tetrahydro-1,4-thiazocine |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C=C\CSCC2)cc1 |
| InChI | InChI=1S/C13H17NO2S2/c1-12-4-6-13(7-5-12)18(15,16)14-8-2-3-10-17-11-9-14/h2-7H,8-11H2,1H3/b3-2- |
| InChIKey | TTWHNGHUMQHIIR-IHWYPQMZSA-N |
| XLogP | 2.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|