C19H19I2NO2S — CID 102497360
(4E)-4,5-diiodo-2-(4-methylphenyl)sulfonyl-1,3,6,7-tetrahydro-2-benzazonine (PubChem CID 102497360) has the molecular formula C19H19I2NO2S and a molecular weight of 579.24 g/mol. Its IUPAC name is (4E)-4,5-diiodo-2-(4-methylphenyl)sulfonyl-1,3,6,7-tetrahydro-2-benzazonine.
| Compound Name | (4E)-4,5-diiodo-2-(4-methylphenyl)sulfonyl-1,3,6,7-tetrahydro-2-benzazonine |
|---|---|
| PubChem CID | 102497360 |
| Molecular Formula | C19H19I2NO2S |
| Molecular Weight | 579.24 g/mol |
| Exact Mass | 578.92 |
| IUPAC Name | (4E)-4,5-diiodo-2-(4-methylphenyl)sulfonyl-1,3,6,7-tetrahydro-2-benzazonine |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(I)=C(\I)CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C19H19I2NO2S/c1-14-6-9-17(10-7-14)25(23,24)22-12-16-5-3-2-4-15(16)8-11-18(20)19(21)13-22/h2-7,9-10H,8,11-13H2,1H3/b19-18+ |
| InChIKey | DDMOLYSPBPPWDY-VHEBQXMUSA-N |
| XLogP | 5.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.24 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|